2-Amino-4'-chlorobenzophenone is an organic compound that serves as a pharmaceutical intermediate. Its structure consists of an aminophenyl group and a chlorophenyl group linked by a ketone moiety, giving it moderate lipophilicity and a polar surface area suitable for synthetic transformations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2894-51-1
8-benzyl-8-azabicyclo[3.2.1]octan-3-one
pharmaceutical intermediate for tropane derivatives
2-(3,5-bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Pharmaceutical intermediate for netupitant synthesis
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-aminophenyl)-(4-chlorophenyl)methanone
APHLSUBLNQBFTM-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N