This compound is a carboxylic acid derivative featuring two trifluoromethyl groups on an aromatic ring. It serves as a pharmaceutical intermediate, primarily used in the manufacturing process for the active pharmaceutical ingredient netupitant.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 289686-70-0
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
3,5-Bis(trifluoromethyl)-alpha,N-dimethylbenzylamine
Pharmaceutical intermediate for research synthesis
2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid
ORLKRFYFNMCQIG-UHFFFAOYSA-N
CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O