tert-Butyl diethylphosphonoacetate is a research reagent commonly used in organic synthesis. It serves as a phosphonate building block for the construction of various chemical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 27784-76-5
(3-Iodophenyl)methanesulfonyl chloride
Research reagent for chemical synthesis
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
Uridine-5'-diphosphate disodium salt
nucleotide sugar research reagent
Thymidine 5'-triphosphate sodium salt
Nucleotide triphosphate for molecular biology
5-Hydroxynicotinic acid
Research reagent
L-Glutamic Acid-d5
Deuterated amino acid analytical standard
tert-butyl 2-diethoxyphosphorylacetate
NFEGNISFSSLEGU-UHFFFAOYSA-N
CCOP(=O)(CC(=O)OC(C)(C)C)OCC
—