(3-Iodophenyl)methanesulfonyl chloride is a chemical compound used as a research reagent in organic synthesis. It features an aromatic ring substituted with iodine and a sulfonyl chloride group, making it a building block for further chemical modifications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 352708-55-5
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
7-bromo-1H-indazole
Research reagent for chemical synthesis
4-fluoro-1H-pyrazole
research compound
Beta-Guanidinopropionic acid
creatine analogue for research
CYCLO(-ASP-ASP)
research compound
(R)-(-)-2-Amino-1-propanol
Research compound and synthetic intermediate
(3-iodophenyl)methanesulfonyl chloride
FWYCOHVQIFJXEL-UHFFFAOYSA-N
C1=CC(=CC(=C1)I)CS(=O)(=O)Cl