This compound is a perdeuterated boronic acid derivative containing a carbazole moiety, used as a labeled research reagent. Its high degree of deuteration makes it valuable in analytical and mechanistic studies where isotope labeling is required.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2778147-31-0
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
9,9'-(6-Chloro-1,3,5-triazine-2,4-diyl)bis(9H-carbazole-1,2,3,4,5,6,7,8-d8)
research compound involving deuterated carbazole-triazine
Tert-Butyl diethylphosphonoacetate
Research reagent for chemical synthesis
Uridine-5'-diphosphate disodium salt
nucleotide sugar research reagent
2-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride)
organic electronics intermediate
[2,3,4,5-tetradeuterio-6-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]boronic acid
MBWDMWMXFNHYLL-AQZSQYOVSA-N
[2H]C1=C(C(=C(C(=C1[2H])B(O)O)N2C3=C(C(=C(C(=C3C4=C(C(=C(C(=C42)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]
—