H-AEEA-AEEA-AEEA is a highly flexible, water-soluble linker compound with multiple ether groups, two amide bonds, and terminal amine and carboxylic acid groups. It is primarily used as a research reagent in linker chemistry for constructing bioconjugates or functionalized molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2773558-06-6
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
pharmaceutical intermediate
Ethyl 4-(phenylmethoxy)-1H-indole-2-carboxylate
research compound
9-(2-bromophenyl-3,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid
deuterated research compound
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
2-[2-[2-[[2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
DLDHTLVGQUKJDC-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O)N