2-Fluorotoluene-alpha,alpha,alpha-D3 is a deuterated research compound, specifically a fluorinated toluene derivative where the methyl group is fully deuterated. It is primarily used as a labeled reagent in analytical and synthetic chemistry studies, particularly for tracing reaction pathways or as an internal standard in mass spectrometry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 25319-49-7
1-BROMO-2-(METHYL-D3)BENZENE
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
2-Fluorotoluene
pharmaceutical intermediate
1-fluoro-2-(trideuteriomethyl)benzene
MMZYCBHLNZVROM-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1F