1-Bromo-2-(methyl-d3)benzene is a deuterated research reagent used in laboratory settings. Its structure features a bromine atom and a fully deuterated methyl group attached to an aromatic ring, making it valuable for isotopic labeling studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 25319-52-2
4-(2H3)methoxybenzoic acid
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
P-TOLUIDINE-D9
Deuterated research reagent
2-Ethylhexanoic-d15 acid
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
Hexanedioic-2,2,3,3,4,4,5,5-d8 acid-1,6-d2
isotopic labeled analytical reference standard
1-bromo-2-(trideuteriomethyl)benzene
QSSXJPIWXQTSIX-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1Br