Morpholino U subunit is a chemical compound used as a building block in the synthesis of morpholino oligonucleotides, which are synthetic molecules employed in research to modulate gene expression. The compound features a morpholine ring, a uracil base, and a phosphorus-containing group, reflecting its role in constructing modified oligonucleotide chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2388517-98-2
(6-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-tritylmorpholin-2-yl)methyl dimethylphosphoramidochloridate)
Phosphoramidate monomer for oligonucleotide synthesis
H-Lys(Boc)-OMe.HCl
Protected lysine derivative for peptide synthesis
Methyl cis-icos-11-enoate
biochemical research reagent
Thioflavin T
fluorescent dye for amyloid detection
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene
research compound for organic synthesis
1-[(2R,6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione
GCLNBTZDWZLIOP-JOLGRYLWSA-N
CN(C)P(=O)(OC[C@@H]1CN(C[C@@H](O1)N2C=CC(=O)NC2=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)Cl