Methyl cis-icos-11-enoate is a long-chain fatty acid ester commonly used as a biochemical research reagent. Its structure features an ester group and one carbon-carbon double bond with cis configuration, contributing to its flexible molecular properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2390-09-2
Methyl laurate
flavoring agent and intermediate
Thioflavin T
fluorescent dye for amyloid detection
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene
research compound for organic synthesis
(S)-ALPHA-METHYLCYSTEINE
research compound
Diethylenetriaminepentaacetic dianhydride
Chemical synthesis intermediate
methyl (E)-icos-11-enoate
RBKMRGOHCLRTLZ-ZHACJKMWSA-N
CCCCCCCC/C=C/CCCCCCCCCC(=O)OC