This compound is a research reagent featuring a chloromethyl-substituted phenoxyethyl group attached to an azepane ring. It is primarily used as a building block in organic synthesis for the preparation of more complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 212771-30-7
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane hydrochloride
pharmaceutical intermediate
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
2-Nitro-1-phenylpropane
Research compound for chemical synthesis
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
1-[2-[4-(chloromethyl)phenoxy]ethyl]azepane
FGCIQSBZGOVNLI-UHFFFAOYSA-N
C1CCCN(CC1)CCOC2=CC=C(C=C2)CCl
—