2-Nitro-1-phenylpropane is a research compound used as a reagent in chemical synthesis. Its structure consists of a nitro group attached to a phenylpropane backbone, and it is primarily employed in laboratory-scale reactions and material preparation.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 17322-34-8
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
2-Amino-5-bromopyrazine
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
(2R,3R,4R,5R)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)-5-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
Nucleotide phosphoramidite building block
2,6-dimethoxypyridin-4-amine
research compound
Methyl 1H-imidazole-2-carboxylate
Research reagent
(5S)-5-[(2R)-2-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one
Vitamin D receptor antagonist research tool
2-nitropropylbenzene
OQBJLKIDAPUHSY-UHFFFAOYSA-N
CC(CC1=CC=CC=C1)[N+](=O)[O-]