Benzo[e]pyrene-d12 is a deuterated form of benzo[e]pyrene used as a reference standard in analytical chemistry. Its twelve hydrogen atoms are replaced with deuterium, making it valuable for isotope dilution mass spectrometry and other quantitative analysis methods.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 205440-82-0
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Perylene, perdeutero-
deuterated reference standard
2,2,4-Tri(methyl-d3)pentane-1,1,1,3,3,4,5,5,5-d9
Deuterated reference standard for analytical chemistry
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
research compound
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
Chain transfer agent for RAFT polymerization
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid
PEG-linked maleimide reagent for conjugation
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[e]pyrene
TXVHTIQJNYSSKO-AQZSQYOVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C4=C3C5=C(C(=C(C(=C25)[2H])[2H])[2H])C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H]