2-Chloro-4-iodo-6-(trifluoromethyl)pyridine is a halogenated pyridine derivative used as a research compound. Its structure features a pyridine ring substituted with chlorine, iodine, and a trifluoromethyl group, giving it distinctive chemical properties for laboratory investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 205444-22-0
3,3',5,5'-Tetraiodothyroformic acid
research compound for thyroid hormone studies
4-((((2-Carboxyethyl)thio)carbonothioyl)thio)-4-cyanopentanoic acid
Chain transfer agent for RAFT polymerization
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid
PEG-linked maleimide reagent for conjugation
(3-(difluoromethoxy)-5-fluorophenyl)boronic acid
research reagent for chemical synthesis
2-chloro-4-iodo-6-(trifluoromethyl)pyridine
JHKQSKCFLAXPKK-UHFFFAOYSA-N
C1=C(C=C(N=C1C(F)(F)F)Cl)I