2,3,4,5-Tetradeuteriothiophene is a deuterated form of thiophene used as a research reagent. Its primary significance lies in providing a labeled compound for spectroscopic studies and mechanistic investigations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2036-39-7
Dopamine-d4 hydrochloride
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
THIOPHENE-2,5-D2
deuterated research compound
Thiofuran
pharmaceutical intermediate and solvent
2,3,4,5-tetradeuteriothiophene
YTPLMLYBLZKORZ-RHQRLBAQSA-N
[2H]C1=C(SC(=C1[2H])[2H])[2H]