This compound is an organic molecule used as a pharmaceutical intermediate. It features a complex structure with multiple amide and aromatic groups, indicating its role as a building block in drug manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 200575-15-1
H-D-Glu-OtBu HCl
peptide synthesis building block
N-Fmoc-N'-trityl-D-glutamine
Peptide synthesis building block
Eldecalcitol interMediates
Eldecalcitol synthetic intermediate
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
4-[[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]-1-methyl-3-propylpyrazole-5-carboxamide
IFFGTBBYPRZJLD-UHFFFAOYSA-N
CCCC1=NN(C(=C1NC(=O)C2=C(C=CC(=C2)S(=O)(=O)N3CCN(CC3)C)OCC)C(=O)N)C