This compound is a synthetic intermediate specifically used in the production of eldecalcitol, a vitamin D analog. It features a cyclohexylidene ethanol core with multiple tert-butyl(dimethyl)silyl protecting groups, which are common in multi-step pharmaceutical synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 200636-42-6
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
Ethyl 3-(2-methoxyphenyl)-2-oxopropanoate
Pharmaceutical intermediate for synthesis
1-(2-Chloroethyl)piperidine hydrochloride
Pharmaceutical intermediate
2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol
Pharmaceutical intermediate for tolterodine synthesis
Cyclohexane, 1,2-bis(methylene)-
chemical intermediate
(Z)-2-((3S,5R)-3,5-bis((tert-butyldiMethylsilyl)oxy)-2-Methylenecyclohexylidene)ethanol
n.a
Elastase
Proteolytic enzyme for research
(3Z)-3-(3-methylbut-2-enylidene)-4-methylidenecyclohexan-1-ol
Reactive dye
(2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol
LKDMRCVDAOOZGO-JZEAMISTSA-N
CC(C)(C)[Si](C)(C)OCCCO[C@@H]1[C@@H](C/C(=C/CO)/C(=C)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C