Boc-Tyr-OtBu is a protected derivative of the amino acid tyrosine, commonly used as a building block in peptide synthesis. Its structure incorporates tert-butoxycarbonyl (Boc) and tert-butyl ester (OtBu) protecting groups, making it suitable for solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 18938-60-8
Boc-Tyr-OMe
Peptide synthesis intermediate
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
Sodium chlorodifluoroacetate
Pharmaceutical intermediate for synthesis
(S)-2-Methyl-1-(6-nitropyridin-3-yl)piperazine
pharmaceutical intermediate
18-(benzyloxy)-18-oxooctadecanoic acid
Pharmaceutical intermediate for synthesis
tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
WGJGINMQCMATNP-AWEZNQCLSA-N
CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OC(C)(C)C