3-Chlorobromobenzene-2,4,5,6-d4 is a deuterated research compound where four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as a stable isotope-labeled reagent in analytical and synthetic chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1643577-43-8
5-bromo-2-phenyl-2H-benzo[d][1,2,3]triazole
research compound
Pyren-1-ylboronic Acid
Research reagent for boronic acid coupling
N'-[9-[(2R,4S,5S)-5-[[2-cyanoethoxy-(diisopropylamino)phosphanyl]oxymethyl]-4-(tritylamino)tetrahydrofuran-2-yl]purin-6-yl]-N,N-dimethyl-formamidine
research chemical for oligonucleotide synthesis
4-(Trifluoromethyl)phenyl isothiocyanate
isothiocyanate reagent for organic synthesis
1-Bromo-3-chlorobenzene
industrial organic synthesis intermediate
1-bromo-3-chloro-2,4,5,6-tetradeuteriobenzene
JRGGUPZKKTVKOV-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Cl)[2H]