Pyren-1-ylboronic acid is a research reagent featuring a boronic acid group attached to a pyrene core, a polycyclic aromatic hydrocarbon. This compound is primarily used in laboratory settings for boronic acid coupling reactions, particularly in the synthesis of organic materials and molecular probes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 164461-18-1
3-(Trimethylsilyl)phenylboronic acid
Research reagent for boronic acid coupling
N'-[9-[(2R,4S,5S)-5-[[2-cyanoethoxy-(diisopropylamino)phosphanyl]oxymethyl]-4-(tritylamino)tetrahydrofuran-2-yl]purin-6-yl]-N,N-dimethyl-formamidine
research chemical for oligonucleotide synthesis
4-(Trifluoromethyl)phenyl isothiocyanate
isothiocyanate reagent for organic synthesis
Glutamic acid diethyl ester
research compound for biochemical studies
(S)-1-(3-Fluoro-4-(trifluoromethoxy)phenyl)-2-methoxyethan-1-amine hydrochloride
laboratory research chemical
1-METHYLPYRENE
Laboratory chemical and intermediate
1-HYDROXYPYRENE
Biomarker for polycyclic aromatic hydrocarbon exposure
Pyrene D10
deuterated internal standard for analysis
pyren-1-ylboronic acid
MWEKPLLMFXIZOC-UHFFFAOYSA-N
B(C1=C2C=CC3=CC=CC4=C3C2=C(C=C1)C=C4)(O)O