This compound is a research reagent with a complex molecular structure featuring an aromatic ring, amide, and ester groups. Its high flexibility and lipophilicity make it suitable for laboratory studies involving conformationally mobile molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 162358-08-9
4,4'-(Cyclopenta-2,4-dien-1-ylidenemethylene)bis(methylbenzene)
Research compound for organometallic chemistry
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
B-1-dibenzofuranylBoronic acid
Boronic acid for chemical synthesis
diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate
RYOKCHIAMHPMLV-UHFFFAOYSA-N
CCCCCCCCC1=CC=C(C=C1)CCC(C(=O)OCC)(C(=O)OCC)NC(=O)C