This compound is a research reagent utilized in organometallic chemistry, characterized by its aromatic ring structure and non-polar nature.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 16259-59-9
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
B-1-dibenzofuranylBoronic acid
Boronic acid for chemical synthesis
(5-methylthiophen-2-yl)boronic Acid
boronic acid research reagent
6,6-bis(p-methoxyphenyl)fulvene
organic synthesis research compound
6,6-Diphenylfulvene
research compound
1-[cyclopenta-2,4-dien-1-ylidene-(4-methylphenyl)methyl]-4-methylbenzene
QGNPNNCBCMUAAA-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(=C2C=CC=C2)C3=CC=C(C=C3)C