Fmoc-Lys(Ac)-OH is a protected amino acid derivative used as a building block in solid-phase peptide synthesis. The Fmoc group protects the alpha-amino group, while the acetylated lysine side chain allows for selective incorporation of acetyllysine into peptide sequences.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 159766-56-0
(2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Protected amino acid for peptide synthesis
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
Z-Lys(Fmoc)-OH
Protected lysine derivative for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Fmoc-N-methyl-L-alloisoleucine
Research compound for peptide synthesis
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
HQLBYVWJOXITAM-NRFANRHFSA-N
CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13