Z-Lys(Fmoc)-OH is a protected lysine derivative commonly used in solid-phase peptide synthesis. It features both a benzyloxycarbonyl (Cbz) protecting group on the alpha-amino group and a fluorenylmethyloxycarbonyl (Fmoc) protecting group on the lysine side chain, enabling selective deprotection strategies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 105751-18-6
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
(2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Protected amino acid for peptide synthesis
Fmoc-Lys(Ac)-OH
Research compound for peptide synthesis
N2,N6-Bis[(phenylmethoxy)carbonyl]-L-lysine
Protected amino acid for peptide synthesis
N6-(tert-Butoxycarbonyl)-N2-((9H-fluoren-9-ylmethoxy)carbonyl)-L-lysine
Protected lysine derivative for peptide synthesis
4-Iodopyridin-3-amine
Pharmaceutical intermediate
Sodium 4-hydroxybenzenesulfonate dihydrate
Pharmaceutical intermediate
(3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinemethanol
pharmaceutical intermediate
(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)hexanoic acid
LNKKPRSYVVUBTR-SANMLTNESA-N
C1=CC=C(C=C1)COC(=O)N[C@@H](CCCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O