This compound is a research reagent designed for click chemistry applications, featuring an azadibenzocyclooctyne (ADIBO) group linked to a carboxylic acid via a polyethylene glycol (PEG) spacer. Its structure enables copper-free strain-promoted azide-alkyne cycloaddition (SPAAC), making it suitable for bioconjugation and labeling studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1537170-85-6
DBCO-PEG4-NHS ester
click chemistry crosslinking reagent
2-(chloromethyl)-4-phenoxybenzoyl chloride
Research chemical intermediate
Tris(2,2'-bipyridine)nickel(II) bromide
cross-coupling catalyst precursor
Trimethylacetic anhydride
Research reagent for organic synthesis
L-Glutamine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester
peptide synthesis intermediate
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
DBCO-(CH2)3-Acid
click chemistry reagent
Dibenzocyclooctyne-amine
click chemistry reagent
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
LKSAMQQFMTVPKD-UHFFFAOYSA-N
C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCC(=O)NCCOCCOCCOCCOCCC(=O)O