Trimethylacetic anhydride is a chemical compound used as a research reagent for organic synthesis. It functions as a derivatization agent in analytical chemistry and serves as a building block for introducing the trimethylacetyl group into target molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1538-75-6
L-Glutamine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester
peptide synthesis intermediate
2-cyclopropyl-1,1-difluoro-3-methoxypropan-2-ol
research compound
2,2'-Dipicolylamine
research reagent for coordination chemistry
5-Fluoro-dl-tryptophan
non-proteinogenic amino acid research compound
2,2-dimethylpropanoyl 2,2-dimethylpropanoate
PGZVFRAEAAXREB-UHFFFAOYSA-N
CC(C)(C)C(=O)OC(=O)C(C)(C)C