(4-Isobutylphenyl)boronic acid is a boronic acid derivative featuring an aromatic ring substituted with an isobutyl group. It is commonly used as a research reagent in organic synthesis and medicinal chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 153624-38-5
Sec-Butylmagnesium chloride
Grignard reagent for organic synthesis
Creatine Ethyl Ester HCL
research compound
Methyl 1H-pyrazole-3-carboxylate
research compound
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
[4-(2-methylpropyl)phenyl]boronic acid
YZSPHVWALUJQNK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CC(C)C)(O)O