This compound is a deuterium-labeled cyclopropanamine derivative used as a research reagent. Its isotopic labeling makes it valuable for analytical and mechanistic studies where tracking molecular fate or kinetics is required.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 153557-95-0
(4-Isobutylphenyl)boronic acid
research compound
Sec-Butylmagnesium chloride
Grignard reagent for organic synthesis
Creatine Ethyl Ester HCL
research compound
Methyl 1H-pyrazole-3-carboxylate
research compound
Cyclopropylamine
precursor to pesticides and pharmaceuticals
1,2,2,3,3-pentadeuteriocyclopropan-1-amine
HTJDQJBWANPRPF-UXXIZXEISA-N
[2H]C1(C(C1([2H])N)([2H])[2H])[2H]
—