Factor B-IN-1 is a research reagent that functions as a complement factor B inhibitor. It is a small-molecule compound investigated for its role in modulating the complement system, specifically the alternative pathway.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1481631-75-7
(S)-(+)-2,3-Diaminopropionic Acid Hydrochloride
Non-protein amino acid research reagent
3-((Aminoiminomethyl)amino)-L-alanine monohydrochloride
Research reagent biochemical reference standard
Thiol-Modifier C6 S-S
Oligonucleotide synthesis linker reagent
Diphenyliodonium chloride
research reagent
2-[hydroxy-(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-3H-benzimidazole-5-carbonitrile
IAUVRHDNBNIFFB-UHFFFAOYSA-N
CC1=CC(=C(C2=C1NC=C2)C(C3=NC4=C(N3)C=C(C=C4)C#N)O)OC