Diphenyliodonium chloride is an iodonium salt used as a research reagent. It consists of a positively charged diphenyliodonium cation paired with a chloride anion.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1483-72-3
Diphenyliodonium nitrate
laboratory research reagent
Methyl 3-(trifluoromethoxy)benzoate
Fine chemical research reagent
4-Methylpyridine-3-Boronic Acid
boronic acid synthetic intermediate
N-ACETYL-L-ALANINE-3,3,3-D3
labeled amino acid derivative
Methyldiphenylphosphine
phosphine ligand for organic synthesis
(4-Methylphenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate
Photoacid generator for polymerization
Iodonium, [4-(octyloxy)phenyl]phenyl-
photoinitiator for polymerization reactions
P-(octyloxyphenyl)phenyliodonium hexafluoroantimonate
photoacid generator for polymerizations
diphenyliodanium chloride
RSJLWBUYLGJOBD-UHFFFAOYSA-M
C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]