14-epi-triptolide is a stereoisomer of triptolide, a diterpenoid epoxide isolated from the traditional Chinese medicinal plant Tripterygium wilfordii. It is primarily used as a research compound to investigate the structure-activity relationships and biological properties of the triptolide scaffold.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 144539-79-7
6-(tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,5-a]pyridine
Research reagent for medicinal chemistry
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
N-Succinimidyl palmitate
crosslinking reagent for bioconjugation
IvDde-L-Lys(Fmoc)-OH
protected amino acid derivative
Triptolide
phytogenic antineoplastic agent
(1S,2S,4S,5S,7R,8S,9S,11S,13S)-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one
DFBIRQPKNDILPW-FKXGARDLSA-N
CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4([C@H]2O)O7)COC6=O)C