N-(tert-Butoxycarbonyl)-L-aspartic acid is a protected derivative of L-aspartic acid commonly used in peptide synthesis. It serves as a pharmaceutical intermediate, where the tert-butoxycarbonyl (Boc) group protects the amino function during peptide chain assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13726-67-5
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
(3S)-4-(tert-butoxy)-3-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoic acid
Protected aspartic acid derivative
L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-
peptide synthesis intermediate
Boc-D-asparagine
peptide building block
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Boc-L-glutamine
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid
KAJBMCZQVSQJDE-YFKPBYRVSA-N
CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(=O)O