Boc-L-glutamine is a protected amino acid derivative commonly used as a building block in peptide synthesis. The compound features a tert-butoxycarbonyl (Boc) protecting group attached to the alpha-amino group, which allows for selective deprotection during solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13726-85-7
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioic acid
Peptide synthesis intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
Boc-lysine
protected amino acid for peptide synthesis
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
O-Benzyl-N-tert-butoxycarbonyl-L-threonine
protected amino acid for peptide synthesis
BOC-ALA
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
VVNYDCGZZSTUBC-LURJTMIESA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)C(=O)O