TDCPP (tris(1,3-dichloroisopropyl)phosphate) is a chlorinated organophosphate compound primarily used as a flame retardant in polyurethane foams. It is structurally related to other chlorinated flame retardants such as TCEP and TCPP.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13674-87-8
1,1'-(Methylenedi-p-phenylene)bismaleimide
intermediate for polymer synthesis
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
tris(1,3-dichloropropan-2-yl) phosphate
ASLWPAWFJZFCKF-UHFFFAOYSA-N
C(C(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl)Cl