This compound is a bismaleimide derivative with two maleimide groups connected by a methylene-bridged diphenyl unit. It is primarily significant as an intermediate used in the synthesis of polymers, particularly for high-performance materials.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13676-54-5
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
Copper dimethyldithiocarbamate
Elastomer accelerator for rubber vulcanization
1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione
XQUPVDVFXZDTLT-UHFFFAOYSA-N
C1=CC(=CC=C1CC2=CC=C(C=C2)N3C(=O)C=CC3=O)N4C(=O)C=CC4=O