This compound is a protected amino acid intermediate used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the nitrogen of 4-hydroxy-L-proline, making it a key building block for the production of modified peptides and pharmaceutical intermediates.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13504-85-3
Dibenzyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
protected proline derivative for peptide synthesis
N-Cbz-cis-4-Hydroxy-L-proline methyl ester
protected proline derivative for peptide synthesis
2-Methyl 1-(phenylmethyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Peptide synthesis building block
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
N-Boc-cis-4-Hydroxy-D-proline
Pharmaceutical intermediate for peptide synthesis
(2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
WWVCWLBEARZMAH-MNOVXSKESA-N
C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O