This compound is an isotope-labeled research reagent, specifically a trideuteriomethylated derivative of a quaternary ammonium compound. It is primarily used in scientific studies to trace metabolic pathways or investigate biological processes due to its stable isotopic labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1334532-17-0
2-Amino Nevirapine-d3
isotope-labeled research compound
Acetaminophen Dimer-d6
isotope-labeled research compound
(1,2,3,4,5,6,7,8-2H8)-9H-carbazole
isotope-labeled research compound
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioic acid
isotope-labeled research compound
(R)-Propionyl Carnitine-d3 Chloride
deuterated research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
[(2R)-2-acetyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
JATPLOXBFFRHDN-WVKKGGDISA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)C.[Cl-]
—