Octanoyl L-Carnitine-d3 Chloride is an isotopically labeled research standard, deuterated at the methyl group attached to the quaternary nitrogen. It is a salt form of the L-carnitine ester with octanoic acid, used primarily as a reference compound in analytical chemistry and metabolic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1334532-24-9
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Stearoyl-L-carnitine-d3 (chloride)
stable isotope labeled reference standard
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
(113C)ethane
isotopically labeled research standard
[(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
MYMFUYYXIJGKKU-HZUATLIXSA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC.[Cl-]
—