Alpha-Benzyloxycarbonylamino-24(ethylene glycol)-omega-propionic acid is a PEGylated linker compound featuring a benzyloxycarbonyl (Cbz) protecting group at one terminus and a propionic acid group at the other. It is primarily used as a research reagent for bioconjugation and surface modification applications due to its flexible polyethylene glycol (PEG) spacer and terminal functional groups.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1334177-88-6
[2-(2-Hydroxy-ethoxy)-ethyl]-carbamic acid benzyl ester
n.a
O-2-(1,3-Dioxoisoindolin-2-yl)ethyl S-methyl carbonodithioate
research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
(R)-Propionyl Carnitine-d3 Chloride
deuterated research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
WVKANAHNXOWXKU-UHFFFAOYSA-N
C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O
—