2-Bromo-3-fluorobenzoic acid is a halogenated benzoic acid derivative used primarily as a research compound. It features both bromine and fluorine substituents on the aromatic ring, contributing to its utility in synthetic chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 132715-69-6
Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate
Research reagent for organic synthesis
2-(2-Bromophenyl)-1H-benzimidazole
research compound for crystallography studies
1,4-Bis(2-methylstyryl)benzene
Scintillation research reagent
2,2'-Bithiophene-5-boronic acid
research compound
2-bromo-3-fluorobenzoic acid
KQRCBMPPEPNNDS-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)Br)C(=O)O