2,2'-Bithiophene-5-boronic acid is a research compound featuring a boronic acid functional group attached to a bithiophene core. It is primarily used as a building block or intermediate in organic synthesis and materials research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 132898-95-4
Dimethyl 5-nitroisophthalate
research compound
Magnesium, bromo(1-methylethenyl)-
Grignard reagent for organic synthesis
Trichloroethylene-d
deuterated chemical research standard
Borane dimethyl sulfide
Complexed borane reagent for hydroboration and reductions
2,2'-Bithiophene
organic electronic material
(Perfluoro-[2,2'-bithiophene]-5,5'-diyl)bis(trimethylstannane)
research compound for organic electronics
3,3'-DIBROMO-5,5'-BIS(TRIMETHYLSILYL)-2,2'-BITHIOPHENE
Organic synthesis building block
(5-thiophen-2-ylthiophen-2-yl)boronic acid
PPHSULIZZOEBDD-UHFFFAOYSA-N
B(C1=CC=C(S1)C2=CC=CS2)(O)O