This compound is a synthetic research peptide composed of eleven amino acid residues. Due to its large size, high flexibility, and multiple undefined stereocenters, it is primarily used as a research compound for laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 131602-53-4
2,4-dichloro-6-methylpyrimidin-5-amine
research compound
(trimethylsilyl)methylmagnesium chloride
Grignard reagent for organic synthesis
Z-Gly-Gly-Phe-OH
research compound
2-(trifluoromethyl)pyridine-4-carboxylic acid
research compound
2-[[2-[[2-[[2-[[2-[2-[[2-[[6-amino-2-[[4-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetyl]amino]propanoylamino]-3-methylpentanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid
WIHBNMPFWRHGDF-UHFFFAOYSA-N
CCC(C)C(C(=O)NC(C(C)CC)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)O)NC(=O)C(C)NC(=O)CNC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)CN