Z-Gly-Gly-Phe-OH is a protected tetrapeptide derivative consisting of glycine, glycine, and phenylalanine residues with a benzyloxycarbonyl (Z) protecting group. It is commonly employed as a research compound in peptide synthesis and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13171-93-2
2-(trifluoromethyl)pyridine-4-carboxylic acid
research compound
2-(Trifluoromethyl)pyridine-3-carboxylic acid
research compound
(2-(trifluoromethyl)pyridin-3-yl)methanol
research compound
(1S)-1-(2-chlorophenyl)ethan-1-ol
research compound
(2S)-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid
PARPWSYTROKYNG-KRWDZBQOSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)OCC2=CC=CC=C2