Clenbuterol D9 is an isotope-labeled research compound, specifically a deuterated form of clenbuterol, featuring nine deuterium atoms. It is commonly used in analytical research as an internal standard for mass spectrometry due to its stable isotope labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 129138-58-5
Clenbuterol-d9 hydrochloride
active pharmaceutical ingredient
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
deuterated research standard
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
2-Amino Nevirapine-d3
isotope-labeled research compound
4-Fluoroaniline-2,3,5,6-d4
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
Phenanthrene D10
isotope-labeled research compound
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-prolinyl-L-proline
research compound for peptide synthesis
1-(4-amino-3,5-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
STJMRWALKKWQGH-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O