This compound is a pentafluoro-λ6-sulfane-substituted phenylboronic ester used as a synthetic building block in chemical research. It features an aromatic ring with a boronate ester group and multiple fluorine atoms, contributing to its potential utility in cross-coupling reactions and molecular design.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1286278-34-9
(R)-N-(Piperidin-3-yl)acetamide
research compound
7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride
ligand for chemical synthesis
Bis(eta(5)-cyclopentadienyl)ruthenium;bis(eta(5)-cyclopentadienyl)ruthenium(II)
research compound
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
pentafluoro-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane
GSABJOBFIHVJIB-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(F)(F)(F)(F)F
—