This compound is a metallocene consisting of a ruthenium atom bound between two cyclopentadiene rings. It is identified as a research reagent and is commonly used in laboratory settings for synthetic and coordination chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1287-13-4
Dicyclopentadienyliron
antiknock gasoline additive
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
(-)-Butorphanol-d6
pharmaceutical reference standard
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
5H-Cyclohepta[b]pyridine, 5-azido-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl]oxy]-, (5S,6S,9R)-
research compound
Ethylferrocene
organoiron compound for chemical synthesis
BKEJVRMLCVMJLG-UHFFFAOYSA-N
C1=C[CH]C=C1.C1=C[CH]C=C1.[Ru]