(3,5-Diphenylphenyl)boronic acid is a boronic acid reagent used in chemical synthesis. It features three aromatic rings and is commonly employed as a building block in organic chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 128388-54-5
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
3-Tolylboronic acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
Biphenyl-2-boronic acid
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Sodium;[hydroxy-[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate
research compound
1-(naphthalen-2-yl)-2-(piperidin-1-yl)ethane-1,2-dione
research compound
Fenoterol-d6 Hydrobromide
Isotopically labelled research compound
(3,5-diphenylphenyl)boronic acid
MRBZYVMZUBUDAX-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O