Biphenyl-2-boronic acid is a boronic acid reagent commonly used in organic synthesis. It consists of two aromatic rings with a boronic acid functional group, making it suitable for Suzuki-type coupling reactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4688-76-0
[2-(3-phenylphenyl)phenyl]boronic acid
Electronic chemical intermediate
(2,4-dimethylphenyl)boronic Acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
1-Kestose
reference standard for fructooligosaccharides
5-Bromothiophene-2-carbaldehyde
research compound
Tris(3-hydroxypropyl)phosphine
reductant for vitamin K epoxide reductase assay
(2-phenylphenyl)boronic acid
HYCYKHYFIWHGEX-UHFFFAOYSA-N
B(C1=CC=CC=C1C2=CC=CC=C2)(O)O