AMPPD disodium salt is a chemiluminescent substrate used primarily in research for detecting alkaline phosphatase activity. The compound consists of a spiroadamantane-dioxetane core with a phosphate group, which upon enzymatic cleavage produces a light signal.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 124951-96-8
Phosphoric acid--trioxotungsten--water (1/12/1)
histochemical staining reagent
7-(m-tolyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide
research compound
(R)-3-(1-HYDROXYETHYL)BENZOIC ACID
Research reagent
Aminofluoro hydroxybenzoate
research compound
disodium;[3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] phosphate
YADDZULXACVKHE-UHFFFAOYSA-L
COC1(C2(C3CC4CC(C3)CC2C4)OO1)C5=CC(=CC=C5)OP(=O)([O-])[O-].[Na+].[Na+]