Aminofluoro hydroxybenzoate is a research compound with a complex aromatic ester structure. It is characterized by the presence of amine, ether, and halogen functional groups, and is used primarily in laboratory research settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1253799-29-9
4-(naphthalen-1-yl)aniline
research compound
((Z)-2-((3R,4R,5R)-3,5-Bis((tert-butyldimethylsilyl)oxy)-4-(3-((tert-butyldiphenylsilyl)oxy)propoxy)-2-methylenecyclohexylidene)ethyl)diphenylphosphine oxide
chemical research reagent
4-Fluoro(phenyl-d4)-boronic acid
research compound
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate
VRXGVVAMXZXKNA-UHFFFAOYSA-N
CC1=C(C=C(C(=C1C(=O)OC2=CC=CC=C2)OCC3=CC=CC=C3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)F